C26H23F6N7O6 — CID 155772448
[4-hydroxy-6-(6-methoxypyrimidin-4-yl)-3-[3-(7-methyl-2,7-diazaspiro[3.5]nonan-2-yl)-1,2,4-triazin-6-yl]-2-(2,2,2-trifluoroacetyl)oxyphenyl] 2,2,2-trifluoroacetate (PubChem CID 155772448) has the molecular formula C26H23F6N7O6 and a molecular weight of 643.50 g/mol. Its IUPAC name is [4-hydroxy-6-(6-methoxypyrimidin-4-yl)-3-[3-(7-methyl-2,7-diazaspiro[3.5]nonan-2-yl)-1,2,4-triazin-6-yl]-2-(2,2,2-trifluoroacetyl)oxyphenyl] 2,2,2-trifluoroacetate.
| Compound Name | [4-hydroxy-6-(6-methoxypyrimidin-4-yl)-3-[3-(7-methyl-2,7-diazaspiro[3.5]nonan-2-yl)-1,2,4-triazin-6-yl]-2-(2,2,2-trifluoroacetyl)oxyphenyl] 2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 155772448 |
| Molecular Formula | C26H23F6N7O6 |
| Molecular Weight | 643.50 g/mol |
| Exact Mass | 643.16 |
| IUPAC Name | [4-hydroxy-6-(6-methoxypyrimidin-4-yl)-3-[3-(7-methyl-2,7-diazaspiro[3.5]nonan-2-yl)-1,2,4-triazin-6-yl]-2-(2,2,2-trifluoroacetyl)oxyphenyl] 2,2,2-trifluoroacetate |
| SMILES | COc1cc(-c2cc(O)c(-c3cnc(N4CC5(CCN(C)CC5)C4)nn3)c(OC(=O)C(F)(F)F)c2OC(=O)C(F)(F)F)ncn1 |
| InChI | InChI=1S/C26H23F6N7O6/c1-38-5-3-24(4-6-38)10-39(11-24)23-33-9-15(36-37-23)18-16(40)7-13(14-8-17(43-2)35-12-34-14)19(44-21(41)25(27,28)29)20(18)45-22(42)26(30,31)32/h7-9,12,40H,3-6,10-11H2,1-2H3 |
| InChIKey | IGXREBFDZCPITI-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 152.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 643.50 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|