C23H23F3N6O4 — CID 155772391
[3-hydroxy-2-[3-(7-methyl-2,7-diazaspiro[3.5]nonan-2-yl)-1,2,4-triazin-6-yl]-5-(2-methyl-1,3-oxazol-5-yl)phenyl] 2,2,2-trifluoroacetate (PubChem CID 155772391) has the molecular formula C23H23F3N6O4 and a molecular weight of 504.47 g/mol. Its IUPAC name is [3-hydroxy-2-[3-(7-methyl-2,7-diazaspiro[3.5]nonan-2-yl)-1,2,4-triazin-6-yl]-5-(2-methyl-1,3-oxazol-5-yl)phenyl] 2,2,2-trifluoroacetate.
| Compound Name | [3-hydroxy-2-[3-(7-methyl-2,7-diazaspiro[3.5]nonan-2-yl)-1,2,4-triazin-6-yl]-5-(2-methyl-1,3-oxazol-5-yl)phenyl] 2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 155772391 |
| Molecular Formula | C23H23F3N6O4 |
| Molecular Weight | 504.47 g/mol |
| Exact Mass | 504.17 |
| IUPAC Name | [3-hydroxy-2-[3-(7-methyl-2,7-diazaspiro[3.5]nonan-2-yl)-1,2,4-triazin-6-yl]-5-(2-methyl-1,3-oxazol-5-yl)phenyl] 2,2,2-trifluoroacetate |
| SMILES | Cc1ncc(-c2cc(O)c(-c3cnc(N4CC5(CCN(C)CC5)C4)nn3)c(OC(=O)C(F)(F)F)c2)o1 |
| InChI | InChI=1S/C23H23F3N6O4/c1-13-27-10-18(35-13)14-7-16(33)19(17(8-14)36-20(34)23(24,25)26)15-9-28-21(30-29-15)32-11-22(12-32)3-5-31(2)6-4-22/h7-10,33H,3-6,11-12H2,1-2H3 |
| InChIKey | YZSFWZGMYRYJHZ-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 117.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.47 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|