About 6-propan-2-yl-2-tritio-1,3-benzothiazole
6-propan-2-yl-2-tritio-1,3-benzothiazole (PubChem CID 155790189) has the molecular formula C10H11NS
and a molecular weight of 179.28 g/mol. Its IUPAC name is 6-propan-2-yl-2-tritio-1,3-benzothiazole.
Molecular Properties
| Compound Name | 6-propan-2-yl-2-tritio-1,3-benzothiazole |
| PubChem CID | 155790189 |
| Molecular Formula | C10H11NS |
| Molecular Weight | 179.28 g/mol |
| Exact Mass | 179.07 |
| IUPAC Name | 6-propan-2-yl-2-tritio-1,3-benzothiazole |
| SMILES | [3H]c1nc2ccc(C(C)C)cc2s1 |
| InChI | InChI=1S/C10H11NS/c1-7(2)8-3-4-9-10(5-8)12-6-11-9/h3-7H,1-2H3/i6T |
| InChIKey | SIZCAMBYKFGFAR-NGIXYFTOSA-N |
| XLogP | 3.42 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 179.28 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 6-propan-2-yl-2-tritio-1,3-benzothiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-propan-2-yl-2-tritio-1,3-benzothiazole?
The IUPAC name of 6-propan-2-yl-2-tritio-1,3-benzothiazole (CID 155790189) is 6-propan-2-yl-2-tritio-1,3-benzothiazole.
What is the SMILES notation for 6-propan-2-yl-2-tritio-1,3-benzothiazole?
The canonical SMILES for 6-propan-2-yl-2-tritio-1,3-benzothiazole is [3H]c1nc2ccc(C(C)C)cc2s1.
What is the InChIKey of 6-propan-2-yl-2-tritio-1,3-benzothiazole?
The InChIKey is SIZCAMBYKFGFAR-NGIXYFTOSA-N. The full InChI is InChI=1S/C10H11NS/c1-7(2)8-3-4-9-10(5-8)12-6-11-9/h3-7H,1-2H3/i6T.
What are the key properties of 6-propan-2-yl-2-tritio-1,3-benzothiazole?
6-propan-2-yl-2-tritio-1,3-benzothiazole has a molecular weight of 179.28 g/mol, XLogP of 3.42, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6-propan-2-yl-2-tritio-1,3-benzothiazole is sourced from PubChem (CID 155790189), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).