C10H11NS — CID 155790204
2-propan-2-yl-5-tritio-1,3-benzothiazole (PubChem CID 155790204) has the molecular formula C10H11NS and a molecular weight of 179.28 g/mol. Its IUPAC name is 2-propan-2-yl-5-tritio-1,3-benzothiazole.
| Compound Name | 2-propan-2-yl-5-tritio-1,3-benzothiazole |
|---|---|
| PubChem CID | 155790204 |
| Molecular Formula | C10H11NS |
| Molecular Weight | 179.28 g/mol |
| Exact Mass | 179.07 |
| IUPAC Name | 2-propan-2-yl-5-tritio-1,3-benzothiazole |
| SMILES | [3H]c1ccc2sc(C(C)C)nc2c1 |
| InChI | InChI=1S/C10H11NS/c1-7(2)10-11-8-5-3-4-6-9(8)12-10/h3-7H,1-2H3/i3T |
| InChIKey | NFRMLNPNLJBPOL-WJULDGBESA-N |
| XLogP | 3.42 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 179.28 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |