C27H33F3NO6P — CID 155796078
benzyl butyl [(3S,4R)-2,2-dimethyl-4-(2-oxopyrrolidin-1-yl)-6-(trifluoromethyl)-3,4-dihydrochromen-3-yl] phosphate (PubChem CID 155796078) has the molecular formula C27H33F3NO6P and a molecular weight of 555.53 g/mol. Its IUPAC name is benzyl butyl [(3S,4R)-2,2-dimethyl-4-(2-oxopyrrolidin-1-yl)-6-(trifluoromethyl)-3,4-dihydrochromen-3-yl] phosphate.
| Compound Name | benzyl butyl [(3S,4R)-2,2-dimethyl-4-(2-oxopyrrolidin-1-yl)-6-(trifluoromethyl)-3,4-dihydrochromen-3-yl] phosphate |
|---|---|
| PubChem CID | 155796078 |
| Molecular Formula | C27H33F3NO6P |
| Molecular Weight | 555.53 g/mol |
| Exact Mass | 555.20 |
| IUPAC Name | benzyl butyl [(3S,4R)-2,2-dimethyl-4-(2-oxopyrrolidin-1-yl)-6-(trifluoromethyl)-3,4-dihydrochromen-3-yl] phosphate |
| SMILES | CCCCOP(=O)(OCc1ccccc1)O[C@H]1[C@H](N2CCCC2=O)c2cc(C(F)(F)F)ccc2OC1(C)C |
| InChI | InChI=1S/C27H33F3NO6P/c1-4-5-16-34-38(33,35-18-19-10-7-6-8-11-19)37-25-24(31-15-9-12-23(31)32)21-17-20(27(28,29)30)13-14-22(21)36-26(25,2)3/h6-8,10-11,13-14,17,24-25H,4-5,9,12,15-16,18H2,1-3H3/t24-,25+,38?/m1/s1 |
| InChIKey | ZDHUCZZWFYOPQL-ZGXOXRIUSA-N |
| XLogP | 7.07 |
| TPSA | 74.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.53 |
| LogP ≤ 5 | 7.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|