C26H19F4N3O3 — CID 155806889
(E)-1-[4-[(6,7-dimethoxyquinazolin-4-yl)amino]phenyl]-3-[2-fluoro-4-(trifluoromethyl)phenyl]prop-2-en-1-one (PubChem CID 155806889) has the molecular formula C26H19F4N3O3 and a molecular weight of 497.45 g/mol. Its IUPAC name is (E)-1-[4-[(6,7-dimethoxyquinazolin-4-yl)amino]phenyl]-3-[2-fluoro-4-(trifluoromethyl)phenyl]prop-2-en-1-one.
| Compound Name | (E)-1-[4-[(6,7-dimethoxyquinazolin-4-yl)amino]phenyl]-3-[2-fluoro-4-(trifluoromethyl)phenyl]prop-2-en-1-one |
|---|---|
| PubChem CID | 155806889 |
| Molecular Formula | C26H19F4N3O3 |
| Molecular Weight | 497.45 g/mol |
| Exact Mass | 497.14 |
| IUPAC Name | (E)-1-[4-[(6,7-dimethoxyquinazolin-4-yl)amino]phenyl]-3-[2-fluoro-4-(trifluoromethyl)phenyl]prop-2-en-1-one |
| SMILES | COc1cc2ncnc(Nc3ccc(C(=O)/C=C/c4ccc(C(F)(F)F)cc4F)cc3)c2cc1OC |
| InChI | InChI=1S/C26H19F4N3O3/c1-35-23-12-19-21(13-24(23)36-2)31-14-32-25(19)33-18-8-4-16(5-9-18)22(34)10-6-15-3-7-17(11-20(15)27)26(28,29)30/h3-14H,1-2H3,(H,31,32,33)/b10-6+ |
| InChIKey | IHQYYAOMDMYRRR-UXBLZVDNSA-N |
| XLogP | 6.44 |
| TPSA | 73.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.45 |
| LogP ≤ 5 | 6.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|