C27H21Cl2N5 — CID 155807564
8,12-bis(4-chlorophenyl)-6-methyl-4-phenyl-2,4,5,11,13-pentazatricyclo[7.4.0.03,7]trideca-1,3(7),5,8-tetraene (PubChem CID 155807564) has the molecular formula C27H21Cl2N5 and a molecular weight of 486.41 g/mol. Its IUPAC name is 8,12-bis(4-chlorophenyl)-6-methyl-4-phenyl-2,4,5,11,13-pentazatricyclo[7.4.0.03,7]trideca-1,3(7),5,8-tetraene.
| Compound Name | 8,12-bis(4-chlorophenyl)-6-methyl-4-phenyl-2,4,5,11,13-pentazatricyclo[7.4.0.03,7]trideca-1,3(7),5,8-tetraene |
|---|---|
| PubChem CID | 155807564 |
| Molecular Formula | C27H21Cl2N5 |
| Molecular Weight | 486.41 g/mol |
| Exact Mass | 485.12 |
| IUPAC Name | 8,12-bis(4-chlorophenyl)-6-methyl-4-phenyl-2,4,5,11,13-pentazatricyclo[7.4.0.03,7]trideca-1,3(7),5,8-tetraene |
| SMILES | Cc1nn(-c2ccccc2)c2nc3c(c(-c4ccc(Cl)cc4)c12)CNC(c1ccc(Cl)cc1)N3 |
| InChI | InChI=1S/C27H21Cl2N5/c1-16-23-24(17-7-11-19(28)12-8-17)22-15-30-25(18-9-13-20(29)14-10-18)31-26(22)32-27(23)34(33-16)21-5-3-2-4-6-21/h2-14,25,30H,15H2,1H3,(H,31,32) |
| InChIKey | XMWBLWMKBNLQJP-UHFFFAOYSA-N |
| XLogP | 6.92 |
| TPSA | 54.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.41 |
| LogP ≤ 5 | 6.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |