C18H26F3N3O5S — CID 155823993
(2R,3aS,7aR)-N-(2-methoxyethyl)-6-[(2-methyl-1,3-thiazol-4-yl)methyl]-3,3a,4,5,7,7a-hexahydro-2H-furo[2,3-c]pyridine-2-carboxamide;2,2,2-trifluoroacetic acid (PubChem CID 155823993) has the molecular formula C18H26F3N3O5S and a molecular weight of 453.48 g/mol. Its IUPAC name is (2R,3aS,7aR)-N-(2-methoxyethyl)-6-[(2-methyl-1,3-thiazol-4-yl)methyl]-3,3a,4,5,7,7a-hexahydro-2H-furo[2,3-c]pyridine-2-carboxamide;2,2,2-trifluoroacetic acid.
| Compound Name | (2R,3aS,7aR)-N-(2-methoxyethyl)-6-[(2-methyl-1,3-thiazol-4-yl)methyl]-3,3a,4,5,7,7a-hexahydro-2H-furo[2,3-c]pyridine-2-carboxamide;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 155823993 |
| Molecular Formula | C18H26F3N3O5S |
| Molecular Weight | 453.48 g/mol |
| Exact Mass | 453.15 |
| IUPAC Name | (2R,3aS,7aR)-N-(2-methoxyethyl)-6-[(2-methyl-1,3-thiazol-4-yl)methyl]-3,3a,4,5,7,7a-hexahydro-2H-furo[2,3-c]pyridine-2-carboxamide;2,2,2-trifluoroacetic acid |
| SMILES | COCCNC(=O)[C@H]1C[C@@H]2CCN(Cc3csc(C)n3)C[C@@H]2O1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C16H25N3O3S.C2HF3O2/c1-11-18-13(10-23-11)8-19-5-3-12-7-14(22-15(12)9-19)16(20)17-4-6-21-2;3-2(4,5)1(6)7/h10,12,14-15H,3-9H2,1-2H3,(H,17,20);(H,6,7)/t12-,14+,15-;/m0./s1 |
| InChIKey | SQLLGKUTHPLRNB-DWGNNRDYSA-N |
| XLogP | 1.83 |
| TPSA | 100.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.48 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|