C16H22F3N3O4S — CID 155827385
(2S,3aS,7aS)-N-methyl-6-[(2-methyl-1,3-thiazol-4-yl)methyl]-3,3a,4,5,7,7a-hexahydro-2H-furo[2,3-c]pyridine-2-carboxamide;2,2,2-trifluoroacetic acid (PubChem CID 155827385) has the molecular formula C16H22F3N3O4S and a molecular weight of 409.43 g/mol. Its IUPAC name is (2S,3aS,7aS)-N-methyl-6-[(2-methyl-1,3-thiazol-4-yl)methyl]-3,3a,4,5,7,7a-hexahydro-2H-furo[2,3-c]pyridine-2-carboxamide;2,2,2-trifluoroacetic acid.
| Compound Name | (2S,3aS,7aS)-N-methyl-6-[(2-methyl-1,3-thiazol-4-yl)methyl]-3,3a,4,5,7,7a-hexahydro-2H-furo[2,3-c]pyridine-2-carboxamide;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 155827385 |
| Molecular Formula | C16H22F3N3O4S |
| Molecular Weight | 409.43 g/mol |
| Exact Mass | 409.13 |
| IUPAC Name | (2S,3aS,7aS)-N-methyl-6-[(2-methyl-1,3-thiazol-4-yl)methyl]-3,3a,4,5,7,7a-hexahydro-2H-furo[2,3-c]pyridine-2-carboxamide;2,2,2-trifluoroacetic acid |
| SMILES | CNC(=O)[C@@H]1C[C@@H]2CCN(Cc3csc(C)n3)C[C@H]2O1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C14H21N3O2S.C2HF3O2/c1-9-16-11(8-20-9)6-17-4-3-10-5-12(14(18)15-2)19-13(10)7-17;3-2(4,5)1(6)7/h8,10,12-13H,3-7H2,1-2H3,(H,15,18);(H,6,7)/t10-,12-,13+;/m0./s1 |
| InChIKey | HDSWQEDKRBTDOE-MXDHMJAMSA-N |
| XLogP | 1.81 |
| TPSA | 91.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.43 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |