C16H22F3N3O5S — CID 155839064
(3R,3aS,6aS)-N-(2-methoxyethyl)-5-(1,3-thiazol-2-ylmethyl)-2,3,3a,4,6,6a-hexahydrofuro[2,3-c]pyrrole-3-carboxamide;2,2,2-trifluoroacetic acid (PubChem CID 155839064) has the molecular formula C16H22F3N3O5S and a molecular weight of 425.43 g/mol. Its IUPAC name is (3R,3aS,6aS)-N-(2-methoxyethyl)-5-(1,3-thiazol-2-ylmethyl)-2,3,3a,4,6,6a-hexahydrofuro[2,3-c]pyrrole-3-carboxamide;2,2,2-trifluoroacetic acid.
| Compound Name | (3R,3aS,6aS)-N-(2-methoxyethyl)-5-(1,3-thiazol-2-ylmethyl)-2,3,3a,4,6,6a-hexahydrofuro[2,3-c]pyrrole-3-carboxamide;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 155839064 |
| Molecular Formula | C16H22F3N3O5S |
| Molecular Weight | 425.43 g/mol |
| Exact Mass | 425.12 |
| IUPAC Name | (3R,3aS,6aS)-N-(2-methoxyethyl)-5-(1,3-thiazol-2-ylmethyl)-2,3,3a,4,6,6a-hexahydrofuro[2,3-c]pyrrole-3-carboxamide;2,2,2-trifluoroacetic acid |
| SMILES | COCCNC(=O)[C@H]1CO[C@@H]2CN(Cc3nccs3)C[C@H]12.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C14H21N3O3S.C2HF3O2/c1-19-4-2-16-14(18)11-9-20-12-7-17(6-10(11)12)8-13-15-3-5-21-13;3-2(4,5)1(6)7/h3,5,10-12H,2,4,6-9H2,1H3,(H,16,18);(H,6,7)/t10-,11+,12-;/m1./s1 |
| InChIKey | WGSDZXPGINXUGJ-QMCLHUHBSA-N |
| XLogP | 0.99 |
| TPSA | 100.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.43 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|