C16H24F3N5O5S — CID 155843105
N-[[(3R,3aS,6aS)-5-[6-(dimethylamino)pyrimidin-4-yl]-2,3,3a,4,6,6a-hexahydrofuro[2,3-c]pyrrol-3-yl]methyl]methanesulfonamide;2,2,2-trifluoroacetic acid (PubChem CID 155843105) has the molecular formula C16H24F3N5O5S and a molecular weight of 455.46 g/mol. Its IUPAC name is N-[[(3R,3aS,6aS)-5-[6-(dimethylamino)pyrimidin-4-yl]-2,3,3a,4,6,6a-hexahydrofuro[2,3-c]pyrrol-3-yl]methyl]methanesulfonamide;2,2,2-trifluoroacetic acid.
| Compound Name | N-[[(3R,3aS,6aS)-5-[6-(dimethylamino)pyrimidin-4-yl]-2,3,3a,4,6,6a-hexahydrofuro[2,3-c]pyrrol-3-yl]methyl]methanesulfonamide;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 155843105 |
| Molecular Formula | C16H24F3N5O5S |
| Molecular Weight | 455.46 g/mol |
| Exact Mass | 455.15 |
| IUPAC Name | N-[[(3R,3aS,6aS)-5-[6-(dimethylamino)pyrimidin-4-yl]-2,3,3a,4,6,6a-hexahydrofuro[2,3-c]pyrrol-3-yl]methyl]methanesulfonamide;2,2,2-trifluoroacetic acid |
| SMILES | CN(C)c1cc(N2C[C@@H]3[C@H](CNS(C)(=O)=O)CO[C@@H]3C2)ncn1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C14H23N5O3S.C2HF3O2/c1-18(2)13-4-14(16-9-15-13)19-6-11-10(5-17-23(3,20)21)8-22-12(11)7-19;3-2(4,5)1(6)7/h4,9-12,17H,5-8H2,1-3H3;(H,6,7)/t10-,11-,12-;/m1./s1 |
| InChIKey | VGPWSQOVMCTZPL-AUYLJXNTSA-N |
| XLogP | 0.18 |
| TPSA | 124.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.46 |
| LogP ≤ 5 | 0.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |