C16H23F3N4O6S — CID 155844414
N-[[(3S,3aS,6aS)-5-(6-methoxypyrimidin-4-yl)-2,3,3a,4,6,6a-hexahydrofuro[2,3-c]pyrrol-3-yl]methyl]ethanesulfonamide;2,2,2-trifluoroacetic acid (PubChem CID 155844414) has the molecular formula C16H23F3N4O6S and a molecular weight of 456.44 g/mol. Its IUPAC name is N-[[(3S,3aS,6aS)-5-(6-methoxypyrimidin-4-yl)-2,3,3a,4,6,6a-hexahydrofuro[2,3-c]pyrrol-3-yl]methyl]ethanesulfonamide;2,2,2-trifluoroacetic acid.
| Compound Name | N-[[(3S,3aS,6aS)-5-(6-methoxypyrimidin-4-yl)-2,3,3a,4,6,6a-hexahydrofuro[2,3-c]pyrrol-3-yl]methyl]ethanesulfonamide;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 155844414 |
| Molecular Formula | C16H23F3N4O6S |
| Molecular Weight | 456.44 g/mol |
| Exact Mass | 456.13 |
| IUPAC Name | N-[[(3S,3aS,6aS)-5-(6-methoxypyrimidin-4-yl)-2,3,3a,4,6,6a-hexahydrofuro[2,3-c]pyrrol-3-yl]methyl]ethanesulfonamide;2,2,2-trifluoroacetic acid |
| SMILES | CCS(=O)(=O)NC[C@H]1CO[C@@H]2CN(c3cc(OC)ncn3)C[C@H]12.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C14H22N4O4S.C2HF3O2/c1-3-23(19,20)17-5-10-8-22-12-7-18(6-11(10)12)13-4-14(21-2)16-9-15-13;3-2(4,5)1(6)7/h4,9-12,17H,3,5-8H2,1-2H3;(H,6,7)/t10-,11+,12+;/m0./s1 |
| InChIKey | HZDREXPSIKBZKP-YBWCDFGXSA-N |
| XLogP | 0.51 |
| TPSA | 130.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.44 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |