C17H23F3N4O6S — CID 155842711
N-[[(3R,3aS,6aS)-5-(6-methoxypyrimidin-4-yl)-2,3,3a,4,6,6a-hexahydrofuro[2,3-c]pyrrol-3-yl]methyl]cyclopropanesulfonamide;2,2,2-trifluoroacetic acid (PubChem CID 155842711) has the molecular formula C17H23F3N4O6S and a molecular weight of 468.45 g/mol. Its IUPAC name is N-[[(3R,3aS,6aS)-5-(6-methoxypyrimidin-4-yl)-2,3,3a,4,6,6a-hexahydrofuro[2,3-c]pyrrol-3-yl]methyl]cyclopropanesulfonamide;2,2,2-trifluoroacetic acid.
| Compound Name | N-[[(3R,3aS,6aS)-5-(6-methoxypyrimidin-4-yl)-2,3,3a,4,6,6a-hexahydrofuro[2,3-c]pyrrol-3-yl]methyl]cyclopropanesulfonamide;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 155842711 |
| Molecular Formula | C17H23F3N4O6S |
| Molecular Weight | 468.45 g/mol |
| Exact Mass | 468.13 |
| IUPAC Name | N-[[(3R,3aS,6aS)-5-(6-methoxypyrimidin-4-yl)-2,3,3a,4,6,6a-hexahydrofuro[2,3-c]pyrrol-3-yl]methyl]cyclopropanesulfonamide;2,2,2-trifluoroacetic acid |
| SMILES | COc1cc(N2C[C@@H]3[C@H](CNS(=O)(=O)C4CC4)CO[C@@H]3C2)ncn1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C15H22N4O4S.C2HF3O2/c1-22-15-4-14(16-9-17-15)19-6-12-10(8-23-13(12)7-19)5-18-24(20,21)11-2-3-11;3-2(4,5)1(6)7/h4,9-13,18H,2-3,5-8H2,1H3;(H,6,7)/t10-,12-,13-;/m1./s1 |
| InChIKey | AZWPOLFJYRVVKK-KPXBVGPJSA-N |
| XLogP | 0.65 |
| TPSA | 130.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.45 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |