C15H21F3N4O6S — CID 155848859
N-[[(3R,3aS,6aS)-5-(6-methoxypyrimidin-4-yl)-2,3,3a,4,6,6a-hexahydrofuro[2,3-c]pyrrol-3-yl]methyl]methanesulfonamide;2,2,2-trifluoroacetic acid (PubChem CID 155848859) has the molecular formula C15H21F3N4O6S and a molecular weight of 442.42 g/mol. Its IUPAC name is N-[[(3R,3aS,6aS)-5-(6-methoxypyrimidin-4-yl)-2,3,3a,4,6,6a-hexahydrofuro[2,3-c]pyrrol-3-yl]methyl]methanesulfonamide;2,2,2-trifluoroacetic acid.
| Compound Name | N-[[(3R,3aS,6aS)-5-(6-methoxypyrimidin-4-yl)-2,3,3a,4,6,6a-hexahydrofuro[2,3-c]pyrrol-3-yl]methyl]methanesulfonamide;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 155848859 |
| Molecular Formula | C15H21F3N4O6S |
| Molecular Weight | 442.42 g/mol |
| Exact Mass | 442.11 |
| IUPAC Name | N-[[(3R,3aS,6aS)-5-(6-methoxypyrimidin-4-yl)-2,3,3a,4,6,6a-hexahydrofuro[2,3-c]pyrrol-3-yl]methyl]methanesulfonamide;2,2,2-trifluoroacetic acid |
| SMILES | COc1cc(N2C[C@@H]3[C@H](CNS(C)(=O)=O)CO[C@@H]3C2)ncn1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C13H20N4O4S.C2HF3O2/c1-20-13-3-12(14-8-15-13)17-5-10-9(4-16-22(2,18)19)7-21-11(10)6-17;3-2(4,5)1(6)7/h3,8-11,16H,4-7H2,1-2H3;(H,6,7)/t9-,10-,11-;/m1./s1 |
| InChIKey | BWDPPRJRUQCFPL-QZXXHOLOSA-N |
| XLogP | 0.12 |
| TPSA | 130.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.42 |
| LogP ≤ 5 | 0.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |