C18H30F3NO5 — CID 155848169
4a-(methoxymethyl)-6-(oxan-4-ylmethyl)-3,4,5,7,8,8a-hexahydro-2H-pyrano[3,2-c]pyridine;2,2,2-trifluoroacetic acid (PubChem CID 155848169) has the molecular formula C18H30F3NO5 and a molecular weight of 397.43 g/mol. Its IUPAC name is 4a-(methoxymethyl)-6-(oxan-4-ylmethyl)-3,4,5,7,8,8a-hexahydro-2H-pyrano[3,2-c]pyridine;2,2,2-trifluoroacetic acid.
| Compound Name | 4a-(methoxymethyl)-6-(oxan-4-ylmethyl)-3,4,5,7,8,8a-hexahydro-2H-pyrano[3,2-c]pyridine;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 155848169 |
| Molecular Formula | C18H30F3NO5 |
| Molecular Weight | 397.43 g/mol |
| Exact Mass | 397.21 |
| IUPAC Name | 4a-(methoxymethyl)-6-(oxan-4-ylmethyl)-3,4,5,7,8,8a-hexahydro-2H-pyrano[3,2-c]pyridine;2,2,2-trifluoroacetic acid |
| SMILES | COCC12CCCOC1CCN(CC1CCOCC1)C2.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C16H29NO3.C2HF3O2/c1-18-13-16-6-2-8-20-15(16)3-7-17(12-16)11-14-4-9-19-10-5-14;3-2(4,5)1(6)7/h14-15H,2-13H2,1H3;(H,6,7) |
| InChIKey | QIZBJBXVJCVKJX-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 68.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.43 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |