C13H14ClN3O4 — CID 155871956
(3aR,6aR)-5-(6-chloropyridine-2-carbonyl)-1,2,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-3-one;formic acid (PubChem CID 155871956) has the molecular formula C13H14ClN3O4 and a molecular weight of 311.73 g/mol. Its IUPAC name is (3aR,6aR)-5-(6-chloropyridine-2-carbonyl)-1,2,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-3-one;formic acid.
| Compound Name | (3aR,6aR)-5-(6-chloropyridine-2-carbonyl)-1,2,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-3-one;formic acid |
|---|---|
| PubChem CID | 155871956 |
| Molecular Formula | C13H14ClN3O4 |
| Molecular Weight | 311.73 g/mol |
| Exact Mass | 311.07 |
| IUPAC Name | (3aR,6aR)-5-(6-chloropyridine-2-carbonyl)-1,2,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-3-one;formic acid |
| SMILES | O=C1NC[C@@H]2CN(C(=O)c3cccc(Cl)n3)C[C@H]12.O=CO |
| InChI | InChI=1S/C12H12ClN3O2.CH2O2/c13-10-3-1-2-9(15-10)12(18)16-5-7-4-14-11(17)8(7)6-16;2-1-3/h1-3,7-8H,4-6H2,(H,14,17);1H,(H,2,3)/t7-,8+;/m1./s1 |
| InChIKey | WKWHKJBYRLGRHI-WLYNEOFISA-N |
| XLogP | 0.25 |
| TPSA | 99.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.73 |
| LogP ≤ 5 | 0.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|