C17H21N3O5S — CID 155874627
N-[[5-(1,3-benzodioxol-5-ylmethylamino)-4,5,6,7-tetrahydro-1,2-benzoxazol-3-yl]methyl]methanesulfonamide (PubChem CID 155874627) has the molecular formula C17H21N3O5S and a molecular weight of 379.44 g/mol. Its IUPAC name is N-[[5-(1,3-benzodioxol-5-ylmethylamino)-4,5,6,7-tetrahydro-1,2-benzoxazol-3-yl]methyl]methanesulfonamide.
| Compound Name | N-[[5-(1,3-benzodioxol-5-ylmethylamino)-4,5,6,7-tetrahydro-1,2-benzoxazol-3-yl]methyl]methanesulfonamide |
|---|---|
| PubChem CID | 155874627 |
| Molecular Formula | C17H21N3O5S |
| Molecular Weight | 379.44 g/mol |
| Exact Mass | 379.12 |
| IUPAC Name | N-[[5-(1,3-benzodioxol-5-ylmethylamino)-4,5,6,7-tetrahydro-1,2-benzoxazol-3-yl]methyl]methanesulfonamide |
| SMILES | CS(=O)(=O)NCc1noc2c1CC(NCc1ccc3c(c1)OCO3)CC2 |
| InChI | InChI=1S/C17H21N3O5S/c1-26(21,22)19-9-14-13-7-12(3-5-15(13)25-20-14)18-8-11-2-4-16-17(6-11)24-10-23-16/h2,4,6,12,18-19H,3,5,7-10H2,1H3 |
| InChIKey | LIZGUFLSJYBRQX-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 102.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.44 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |