C16H18FN5O2 — CID 155879678
1-(2-fluoropyridine-4-carbonyl)-N-methyl-3-pyrazol-1-ylpiperidine-3-carboxamide (PubChem CID 155879678) has the molecular formula C16H18FN5O2 and a molecular weight of 331.35 g/mol. Its IUPAC name is 1-(2-fluoropyridine-4-carbonyl)-N-methyl-3-pyrazol-1-ylpiperidine-3-carboxamide.
| Compound Name | 1-(2-fluoropyridine-4-carbonyl)-N-methyl-3-pyrazol-1-ylpiperidine-3-carboxamide |
|---|---|
| PubChem CID | 155879678 |
| Molecular Formula | C16H18FN5O2 |
| Molecular Weight | 331.35 g/mol |
| Exact Mass | 331.14 |
| IUPAC Name | 1-(2-fluoropyridine-4-carbonyl)-N-methyl-3-pyrazol-1-ylpiperidine-3-carboxamide |
| SMILES | CNC(=O)C1(n2cccn2)CCCN(C(=O)c2ccnc(F)c2)C1 |
| InChI | InChI=1S/C16H18FN5O2/c1-18-15(24)16(22-9-3-6-20-22)5-2-8-21(11-16)14(23)12-4-7-19-13(17)10-12/h3-4,6-7,9-10H,2,5,8,11H2,1H3,(H,18,24) |
| InChIKey | SFMNDFNEKAHJIJ-UHFFFAOYSA-N |
| XLogP | 0.79 |
| TPSA | 80.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.35 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|