C21H25FN2O2S — CID 155902728
2-benzylsulfonyl-7-[(3-fluorophenyl)methyl]-2,7-diazaspiro[4.4]nonane (PubChem CID 155902728) has the molecular formula C21H25FN2O2S and a molecular weight of 388.51 g/mol. Its IUPAC name is 2-benzylsulfonyl-7-[(3-fluorophenyl)methyl]-2,7-diazaspiro[4.4]nonane.
| Compound Name | 2-benzylsulfonyl-7-[(3-fluorophenyl)methyl]-2,7-diazaspiro[4.4]nonane |
|---|---|
| PubChem CID | 155902728 |
| Molecular Formula | C21H25FN2O2S |
| Molecular Weight | 388.51 g/mol |
| Exact Mass | 388.16 |
| IUPAC Name | 2-benzylsulfonyl-7-[(3-fluorophenyl)methyl]-2,7-diazaspiro[4.4]nonane |
| SMILES | O=S(=O)(Cc1ccccc1)N1CCC2(CCN(Cc3cccc(F)c3)C2)C1 |
| InChI | InChI=1S/C21H25FN2O2S/c22-20-8-4-7-19(13-20)14-23-11-9-21(16-23)10-12-24(17-21)27(25,26)15-18-5-2-1-3-6-18/h1-8,13H,9-12,14-17H2 |
| InChIKey | RJAQPZJRHCVQRX-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.51 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |