C27H28ClN3O5 — CID 155903482
(2R,4R)-5-[4-(3-chlorophenyl)phenyl]-2-hydroxy-4-[[5-(2-hydroxyphenyl)pyrazolidine-3-carbonyl]amino]pentanoic acid (PubChem CID 155903482) has the molecular formula C27H28ClN3O5 and a molecular weight of 509.99 g/mol. Its IUPAC name is (2R,4R)-5-[4-(3-chlorophenyl)phenyl]-2-hydroxy-4-[[5-(2-hydroxyphenyl)pyrazolidine-3-carbonyl]amino]pentanoic acid.
| Compound Name | (2R,4R)-5-[4-(3-chlorophenyl)phenyl]-2-hydroxy-4-[[5-(2-hydroxyphenyl)pyrazolidine-3-carbonyl]amino]pentanoic acid |
|---|---|
| PubChem CID | 155903482 |
| Molecular Formula | C27H28ClN3O5 |
| Molecular Weight | 509.99 g/mol |
| Exact Mass | 509.17 |
| IUPAC Name | (2R,4R)-5-[4-(3-chlorophenyl)phenyl]-2-hydroxy-4-[[5-(2-hydroxyphenyl)pyrazolidine-3-carbonyl]amino]pentanoic acid |
| SMILES | O=C(N[C@H](Cc1ccc(-c2cccc(Cl)c2)cc1)C[C@@H](O)C(=O)O)C1CC(c2ccccc2O)NN1 |
| InChI | InChI=1S/C27H28ClN3O5/c28-19-5-3-4-18(13-19)17-10-8-16(9-11-17)12-20(14-25(33)27(35)36)29-26(34)23-15-22(30-31-23)21-6-1-2-7-24(21)32/h1-11,13,20,22-23,25,30-33H,12,14-15H2,(H,29,34)(H,35,36)/t20-,22?,23?,25-/m1/s1 |
| InChIKey | FGSZCGQBIBUIFX-ROBYLQBCSA-N |
| XLogP | 3.18 |
| TPSA | 130.92 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.99 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|