C13H10N2 — CID 155907012
2-phenylpyrrolo[1,2-a]pyrimidine (PubChem CID 155907012) has the molecular formula C13H10N2 and a molecular weight of 194.24 g/mol. Its IUPAC name is 2-phenylpyrrolo[1,2-a]pyrimidine.
| Compound Name | 2-phenylpyrrolo[1,2-a]pyrimidine |
|---|---|
| PubChem CID | 155907012 |
| Molecular Formula | C13H10N2 |
| Molecular Weight | 194.24 g/mol |
| Exact Mass | 194.08 |
| IUPAC Name | 2-phenylpyrrolo[1,2-a]pyrimidine |
| SMILES | c1ccc(-c2ccn3cccc3n2)cc1 |
| InChI | InChI=1S/C13H10N2/c1-2-5-11(6-3-1)12-8-10-15-9-4-7-13(15)14-12/h1-10H |
| InChIKey | ILQKVHWWSGVWDO-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 17.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.24 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |