C33H38N8O5S — CID 155916843
(15S)-15-benzyl-10-(2-methyl-5-pyrazol-1-ylphenyl)sulfonyl-2,5,10,13,16,19-hexazabicyclo[16.3.1]docosa-1(22),18,20-triene-6,14,17-trione (PubChem CID 155916843) has the molecular formula C33H38N8O5S and a molecular weight of 658.79 g/mol. Its IUPAC name is (15S)-15-benzyl-10-(2-methyl-5-pyrazol-1-ylphenyl)sulfonyl-2,5,10,13,16,19-hexazabicyclo[16.3.1]docosa-1(22),18,20-triene-6,14,17-trione.
| Compound Name | (15S)-15-benzyl-10-(2-methyl-5-pyrazol-1-ylphenyl)sulfonyl-2,5,10,13,16,19-hexazabicyclo[16.3.1]docosa-1(22),18,20-triene-6,14,17-trione |
|---|---|
| PubChem CID | 155916843 |
| Molecular Formula | C33H38N8O5S |
| Molecular Weight | 658.79 g/mol |
| Exact Mass | 658.27 |
| IUPAC Name | (15S)-15-benzyl-10-(2-methyl-5-pyrazol-1-ylphenyl)sulfonyl-2,5,10,13,16,19-hexazabicyclo[16.3.1]docosa-1(22),18,20-triene-6,14,17-trione |
| SMILES | Cc1ccc(-n2cccn2)cc1S(=O)(=O)N1CCCC(=O)NCCNc2ccnc(c2)C(=O)N[C@@H](Cc2ccccc2)C(=O)NCC1 |
| InChI | InChI=1S/C33H38N8O5S/c1-24-10-11-27(41-19-6-13-38-41)23-30(24)47(45,46)40-18-5-9-31(42)36-16-15-34-26-12-14-35-28(22-26)33(44)39-29(32(43)37-17-20-40)21-25-7-3-2-4-8-25/h2-4,6-8,10-14,19,22-23,29,34H,5,9,15-18,20-21H2,1H3,(H,36,42)(H,37,43)(H,39,44)/t29-/m0/s1 |
| InChIKey | OXZITFXJALNJIE-LJAQVGFWSA-N |
| XLogP | 2.05 |
| TPSA | 167.42 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 47 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 658.79 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |