C16H10Cl2N4O5 — CID 155924553
3-(3,4-dichlorophenyl)-5-[2-(3,5-dinitrophenyl)ethyl]-1,2,4-oxadiazole (PubChem CID 155924553) has the molecular formula C16H10Cl2N4O5 and a molecular weight of 409.19 g/mol. Its IUPAC name is 3-(3,4-dichlorophenyl)-5-[2-(3,5-dinitrophenyl)ethyl]-1,2,4-oxadiazole.
| Compound Name | 3-(3,4-dichlorophenyl)-5-[2-(3,5-dinitrophenyl)ethyl]-1,2,4-oxadiazole |
|---|---|
| PubChem CID | 155924553 |
| Molecular Formula | C16H10Cl2N4O5 |
| Molecular Weight | 409.19 g/mol |
| Exact Mass | 408.00 |
| IUPAC Name | 3-(3,4-dichlorophenyl)-5-[2-(3,5-dinitrophenyl)ethyl]-1,2,4-oxadiazole |
| SMILES | O=[N+]([O-])c1cc(CCc2nc(-c3ccc(Cl)c(Cl)c3)no2)cc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C16H10Cl2N4O5/c17-13-3-2-10(7-14(13)18)16-19-15(27-20-16)4-1-9-5-11(21(23)24)8-12(6-9)22(25)26/h2-3,5-8H,1,4H2 |
| InChIKey | CSHMVHDIVFKKEB-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 125.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.19 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|