C23H22FN5O2S2 — CID 155925258
US12331044, Example 7 (PubChem CID 155925258) has the molecular formula C23H22FN5O2S2 and a molecular weight of 483.60 g/mol. Its IUPAC name is N-[(1S)-1-[5-(4-fluorophenyl)-1H-imidazol-2-yl]-7-oxo-7-(1,3-thiazol-2-yl)heptyl]-1,3-thiazole-5-carboxamide.
| Compound Name | US12331044, Example 7 |
|---|---|
| PubChem CID | 155925258 |
| Molecular Formula | C23H22FN5O2S2 |
| Molecular Weight | 483.60 g/mol |
| Exact Mass | 483.12 |
| IUPAC Name | N-[(1S)-1-[5-(4-fluorophenyl)-1H-imidazol-2-yl]-7-oxo-7-(1,3-thiazol-2-yl)heptyl]-1,3-thiazole-5-carboxamide |
| SMILES | C1=CC(=CC=C1C2=CN=C(N2)[C@H](CCCCCC(=O)C3=NC=CS3)NC(=O)C4=CN=CS4)F |
| InChI | InChI=1S/C23H22FN5O2S2/c24-16-8-6-15(7-9-16)18-12-27-21(28-18)17(29-22(31)20-13-25-14-33-20)4-2-1-3-5-19(30)23-26-10-11-32-23/h6-14,17H,1-5H2,(H,27,28)(H,29,31)/t17-/m0/s1 |
| InChIKey | XUAMASKDNXGLSO-KRWDZBQOSA-N |
| XLogP | 4.30 |
| TPSA | 157.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | 652 |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.60 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|