C21H17N3O4 — CID 155927778
N'-[3-cyano-4-(furan-2-yl)-9-methyl-5-oxo-4H-pyrano[3,2-c]chromen-2-yl]-N,N-dimethylmethanimidamide (PubChem CID 155927778) has the molecular formula C21H17N3O4 and a molecular weight of 375.38 g/mol. Its IUPAC name is N'-[3-cyano-4-(furan-2-yl)-9-methyl-5-oxo-4H-pyrano[3,2-c]chromen-2-yl]-N,N-dimethylmethanimidamide.
| Compound Name | N'-[3-cyano-4-(furan-2-yl)-9-methyl-5-oxo-4H-pyrano[3,2-c]chromen-2-yl]-N,N-dimethylmethanimidamide |
|---|---|
| PubChem CID | 155927778 |
| Molecular Formula | C21H17N3O4 |
| Molecular Weight | 375.38 g/mol |
| Exact Mass | 375.12 |
| IUPAC Name | N'-[3-cyano-4-(furan-2-yl)-9-methyl-5-oxo-4H-pyrano[3,2-c]chromen-2-yl]-N,N-dimethylmethanimidamide |
| SMILES | Cc1ccc2oc(=O)c3c(c2c1)OC(/N=C/N(C)C)=C(C#N)C3c1ccco1 |
| InChI | InChI=1S/C21H17N3O4/c1-12-6-7-15-13(9-12)19-18(21(25)27-15)17(16-5-4-8-26-16)14(10-22)20(28-19)23-11-24(2)3/h4-9,11,17H,1-3H3/b23-11+ |
| InChIKey | CTNGHMKZLATBNT-FOKLQQMPSA-N |
| XLogP | 3.54 |
| TPSA | 91.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.38 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|