About 5-[1-(4-chlorophenyl)-4,5-diphenylimidazol-2-yl]-2-hydroxy-3-methoxybenzaldehyde
5-[1-(4-chlorophenyl)-4,5-diphenylimidazol-2-yl]-2-hydroxy-3-methoxybenzaldehyde (PubChem CID 155928284) has the molecular formula C29H21ClN2O3
and a molecular weight of 480.95 g/mol. Its IUPAC name is 5-[1-(4-chlorophenyl)-4,5-diphenylimidazol-2-yl]-2-hydroxy-3-methoxybenzaldehyde.
Molecular Properties
| Compound Name | 5-[1-(4-chlorophenyl)-4,5-diphenylimidazol-2-yl]-2-hydroxy-3-methoxybenzaldehyde |
| PubChem CID | 155928284 |
| Molecular Formula | C29H21ClN2O3 |
| Molecular Weight | 480.95 g/mol |
| Exact Mass | 480.12 |
| IUPAC Name | 5-[1-(4-chlorophenyl)-4,5-diphenylimidazol-2-yl]-2-hydroxy-3-methoxybenzaldehyde |
| SMILES | COc1cc(-c2nc(-c3ccccc3)c(-c3ccccc3)n2-c2ccc(Cl)cc2)cc(C=O)c1O |
| InChI | InChI=1S/C29H21ClN2O3/c1-35-25-17-21(16-22(18-33)28(25)34)29-31-26(19-8-4-2-5-9-19)27(20-10-6-3-7-11-20)32(29)24-14-12-23(30)13-15-24/h2-18,34H,1H3 |
| InChIKey | MHURJSFOCDCNCI-UHFFFAOYSA-N |
| XLogP | 7.05 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 480.95 |
| LogP ≤ 5 | 7.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 5-[1-(4-chlorophenyl)-4,5-diphenylimidazol-2-yl]-2-hydroxy-3-methoxybenzaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[1-(4-chlorophenyl)-4,5-diphenylimidazol-2-yl]-2-hydroxy-3-methoxybenzaldehyde?
The IUPAC name of 5-[1-(4-chlorophenyl)-4,5-diphenylimidazol-2-yl]-2-hydroxy-3-methoxybenzaldehyde (CID 155928284) is 5-[1-(4-chlorophenyl)-4,5-diphenylimidazol-2-yl]-2-hydroxy-3-methoxybenzaldehyde.
What is the SMILES notation for 5-[1-(4-chlorophenyl)-4,5-diphenylimidazol-2-yl]-2-hydroxy-3-methoxybenzaldehyde?
The canonical SMILES for 5-[1-(4-chlorophenyl)-4,5-diphenylimidazol-2-yl]-2-hydroxy-3-methoxybenzaldehyde is COc1cc(-c2nc(-c3ccccc3)c(-c3ccccc3)n2-c2ccc(Cl)cc2)cc(C=O)c1O.
What is the InChIKey of 5-[1-(4-chlorophenyl)-4,5-diphenylimidazol-2-yl]-2-hydroxy-3-methoxybenzaldehyde?
The InChIKey is MHURJSFOCDCNCI-UHFFFAOYSA-N. The full InChI is InChI=1S/C29H21ClN2O3/c1-35-25-17-21(16-22(18-33)28(25)34)29-31-26(19-8-4-2-5-9-19)27(20-10-6-3-7-11-20)32(29)24-14-12-23(30)13-15-24/h2-18,34H,1H3.
What are the key properties of 5-[1-(4-chlorophenyl)-4,5-diphenylimidazol-2-yl]-2-hydroxy-3-methoxybenzaldehyde?
5-[1-(4-chlorophenyl)-4,5-diphenylimidazol-2-yl]-2-hydroxy-3-methoxybenzaldehyde has a molecular weight of 480.95 g/mol, XLogP of 7.05, 6 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[1-(4-chlorophenyl)-4,5-diphenylimidazol-2-yl]-2-hydroxy-3-methoxybenzaldehyde is sourced from PubChem (CID 155928284), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).