C15H13N3O3 — CID 155936683
2-(benzotriazol-1-yl)-4,5-dimethoxybenzaldehyde (PubChem CID 155936683) has the molecular formula C15H13N3O3 and a molecular weight of 283.29 g/mol. Its IUPAC name is 2-(benzotriazol-1-yl)-4,5-dimethoxybenzaldehyde.
| Compound Name | 2-(benzotriazol-1-yl)-4,5-dimethoxybenzaldehyde |
|---|---|
| PubChem CID | 155936683 |
| Molecular Formula | C15H13N3O3 |
| Molecular Weight | 283.29 g/mol |
| Exact Mass | 283.10 |
| IUPAC Name | 2-(benzotriazol-1-yl)-4,5-dimethoxybenzaldehyde |
| SMILES | COc1cc(C=O)c(-n2nnc3ccccc32)cc1OC |
| InChI | InChI=1S/C15H13N3O3/c1-20-14-7-10(9-19)13(8-15(14)21-2)18-12-6-4-3-5-11(12)16-17-18/h3-9H,1-2H3 |
| InChIKey | WKEGPBVAWNYPNC-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 66.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.29 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|