C16H19N5O5S — CID 155939260
formic acid;3-[5-[1-[(3R,4R)-4-methoxyoxolan-3-yl]imidazol-2-yl]furan-2-yl]sulfanyl-4-methyl-1,2,4-triazole (PubChem CID 155939260) has the molecular formula C16H19N5O5S and a molecular weight of 393.43 g/mol. Its IUPAC name is formic acid;3-[5-[1-[(3R,4R)-4-methoxyoxolan-3-yl]imidazol-2-yl]furan-2-yl]sulfanyl-4-methyl-1,2,4-triazole.
| Compound Name | formic acid;3-[5-[1-[(3R,4R)-4-methoxyoxolan-3-yl]imidazol-2-yl]furan-2-yl]sulfanyl-4-methyl-1,2,4-triazole |
|---|---|
| PubChem CID | 155939260 |
| Molecular Formula | C16H19N5O5S |
| Molecular Weight | 393.43 g/mol |
| Exact Mass | 393.11 |
| IUPAC Name | formic acid;3-[5-[1-[(3R,4R)-4-methoxyoxolan-3-yl]imidazol-2-yl]furan-2-yl]sulfanyl-4-methyl-1,2,4-triazole |
| SMILES | CO[C@H]1COC[C@H]1n1ccnc1-c1ccc(Sc2nncn2C)o1.O=CO |
| InChI | InChI=1S/C15H17N5O3S.CH2O2/c1-19-9-17-18-15(19)24-13-4-3-11(23-13)14-16-5-6-20(14)10-7-22-8-12(10)21-2;2-1-3/h3-6,9-10,12H,7-8H2,1-2H3;1H,(H,2,3)/t10-,12+;/m1./s1 |
| InChIKey | BVFYGQQHCMYMOX-IYJPBCIQSA-N |
| XLogP | 1.71 |
| TPSA | 117.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.43 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|