C20H20F5N3O3S — CID 155946191
6-[2-[1-(2,4-difluorophenyl)propylamino]ethyl]-7-methyl-[1,3]thiazolo[3,2-a]pyrimidin-5-one;2,2,2-trifluoroacetic acid (PubChem CID 155946191) has the molecular formula C20H20F5N3O3S and a molecular weight of 477.46 g/mol. Its IUPAC name is 6-[2-[1-(2,4-difluorophenyl)propylamino]ethyl]-7-methyl-[1,3]thiazolo[3,2-a]pyrimidin-5-one;2,2,2-trifluoroacetic acid.
| Compound Name | 6-[2-[1-(2,4-difluorophenyl)propylamino]ethyl]-7-methyl-[1,3]thiazolo[3,2-a]pyrimidin-5-one;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 155946191 |
| Molecular Formula | C20H20F5N3O3S |
| Molecular Weight | 477.46 g/mol |
| Exact Mass | 477.11 |
| IUPAC Name | 6-[2-[1-(2,4-difluorophenyl)propylamino]ethyl]-7-methyl-[1,3]thiazolo[3,2-a]pyrimidin-5-one;2,2,2-trifluoroacetic acid |
| SMILES | CCC(NCCc1c(C)nc2sccn2c1=O)c1ccc(F)cc1F.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C18H19F2N3OS.C2HF3O2/c1-3-16(14-5-4-12(19)10-15(14)20)21-7-6-13-11(2)22-18-23(17(13)24)8-9-25-18;3-2(4,5)1(6)7/h4-5,8-10,16,21H,3,6-7H2,1-2H3;(H,6,7) |
| InChIKey | ZCAYDMBFBOFEBX-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 83.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.46 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |