C9H17N2O5P — CID 15598006
[acetyl-(2-oxopyrrolidin-3-yl)amino]methyl-ethoxyphosphinic acid (PubChem CID 15598006) has the molecular formula C9H17N2O5P and a molecular weight of 264.22 g/mol. Its IUPAC name is [acetyl-(2-oxopyrrolidin-3-yl)amino]methyl-ethoxyphosphinic acid.
| Compound Name | [acetyl-(2-oxopyrrolidin-3-yl)amino]methyl-ethoxyphosphinic acid |
|---|---|
| PubChem CID | 15598006 |
| Molecular Formula | C9H17N2O5P |
| Molecular Weight | 264.22 g/mol |
| Exact Mass | 264.09 |
| IUPAC Name | [acetyl-(2-oxopyrrolidin-3-yl)amino]methyl-ethoxyphosphinic acid |
| SMILES | CCOP(=O)(O)CN(C(C)=O)C1CCNC1=O |
| InChI | InChI=1S/C9H17N2O5P/c1-3-16-17(14,15)6-11(7(2)12)8-4-5-10-9(8)13/h8H,3-6H2,1-2H3,(H,10,13)(H,14,15) |
| InChIKey | YRMAXLQMAKTAOO-UHFFFAOYSA-N |
| XLogP | -0.10 |
| TPSA | 95.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.22 |
| LogP ≤ 5 | -0.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|