C18H23N5O — CID 155984112
[(3aR,4R,7aS)-4-(pyrazin-2-ylmethyl)-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl]-(1-methylpyrazol-4-yl)methanone (PubChem CID 155984112) has the molecular formula C18H23N5O and a molecular weight of 325.42 g/mol. Its IUPAC name is [(3aR,4R,7aS)-4-(pyrazin-2-ylmethyl)-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl]-(1-methylpyrazol-4-yl)methanone.
| Compound Name | [(3aR,4R,7aS)-4-(pyrazin-2-ylmethyl)-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl]-(1-methylpyrazol-4-yl)methanone |
|---|---|
| PubChem CID | 155984112 |
| Molecular Formula | C18H23N5O |
| Molecular Weight | 325.42 g/mol |
| Exact Mass | 325.19 |
| IUPAC Name | [(3aR,4R,7aS)-4-(pyrazin-2-ylmethyl)-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl]-(1-methylpyrazol-4-yl)methanone |
| SMILES | Cn1cc(C(=O)N2C[C@H]3CCC[C@H](Cc4cnccn4)[C@H]3C2)cn1 |
| InChI | InChI=1S/C18H23N5O/c1-22-10-15(8-21-22)18(24)23-11-14-4-2-3-13(17(14)12-23)7-16-9-19-5-6-20-16/h5-6,8-10,13-14,17H,2-4,7,11-12H2,1H3/t13-,14-,17-/m1/s1 |
| InChIKey | HDUQOOWPHUTSIX-CKEIUWERSA-N |
| XLogP | 1.94 |
| TPSA | 63.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.42 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |