C20H24N4O — CID 110138488
[(3aR,4R,7aS)-4-[(2-methylpyrimidin-4-yl)methyl]-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl]-pyridin-4-ylmethanone (PubChem CID 110138488) has the molecular formula C20H24N4O and a molecular weight of 336.44 g/mol. Its IUPAC name is [(3aR,4R,7aS)-4-[(2-methylpyrimidin-4-yl)methyl]-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl]-pyridin-4-ylmethanone.
| Compound Name | [(3aR,4R,7aS)-4-[(2-methylpyrimidin-4-yl)methyl]-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl]-pyridin-4-ylmethanone |
|---|---|
| PubChem CID | 110138488 |
| Molecular Formula | C20H24N4O |
| Molecular Weight | 336.44 g/mol |
| Exact Mass | 336.20 |
| IUPAC Name | [(3aR,4R,7aS)-4-[(2-methylpyrimidin-4-yl)methyl]-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl]-pyridin-4-ylmethanone |
| SMILES | Cc1nccc(C[C@H]2CCC[C@@H]3CN(C(=O)c4ccncc4)C[C@H]23)n1 |
| InChI | InChI=1S/C20H24N4O/c1-14-22-10-7-18(23-14)11-16-3-2-4-17-12-24(13-19(16)17)20(25)15-5-8-21-9-6-15/h5-10,16-17,19H,2-4,11-13H2,1H3/t16-,17-,19-/m1/s1 |
| InChIKey | QNTZMYRQKVADST-ZHALLVOQSA-N |
| XLogP | 2.91 |
| TPSA | 58.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.44 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |