C20H19NO2 — CID 15617916
3-benzyl-4-hydroxy-N,N-dimethylnaphthalene-1-carboxamide (PubChem CID 15617916) has the molecular formula C20H19NO2 and a molecular weight of 305.38 g/mol. Its IUPAC name is 3-benzyl-4-hydroxy-N,N-dimethylnaphthalene-1-carboxamide.
| Compound Name | 3-benzyl-4-hydroxy-N,N-dimethylnaphthalene-1-carboxamide |
|---|---|
| PubChem CID | 15617916 |
| Molecular Formula | C20H19NO2 |
| Molecular Weight | 305.38 g/mol |
| Exact Mass | 305.14 |
| IUPAC Name | 3-benzyl-4-hydroxy-N,N-dimethylnaphthalene-1-carboxamide |
| SMILES | CN(C)C(=O)c1cc(Cc2ccccc2)c(O)c2ccccc12 |
| InChI | InChI=1S/C20H19NO2/c1-21(2)20(23)18-13-15(12-14-8-4-3-5-9-14)19(22)17-11-7-6-10-16(17)18/h3-11,13,22H,12H2,1-2H3 |
| InChIKey | DCMRVYUJYJFOSE-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.38 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |