C17H17NO — CID 15628560
(1R,9S)-13-methoxy-1-methyl-16-azatetracyclo[7.6.1.02,7.010,15]hexadeca-2,4,6,10(15),11,13-hexaene (PubChem CID 15628560) has the molecular formula C17H17NO and a molecular weight of 251.33 g/mol. Its IUPAC name is (1R,9S)-13-methoxy-1-methyl-16-azatetracyclo[7.6.1.02,7.010,15]hexadeca-2,4,6,10(15),11,13-hexaene.
| Compound Name | (1R,9S)-13-methoxy-1-methyl-16-azatetracyclo[7.6.1.02,7.010,15]hexadeca-2,4,6,10(15),11,13-hexaene |
|---|---|
| PubChem CID | 15628560 |
| Molecular Formula | C17H17NO |
| Molecular Weight | 251.33 g/mol |
| Exact Mass | 251.13 |
| IUPAC Name | (1R,9S)-13-methoxy-1-methyl-16-azatetracyclo[7.6.1.02,7.010,15]hexadeca-2,4,6,10(15),11,13-hexaene |
| SMILES | COc1ccc2c(c1)[C@]1(C)N[C@H]2Cc2ccccc21 |
| InChI | InChI=1S/C17H17NO/c1-17-14-6-4-3-5-11(14)9-16(18-17)13-8-7-12(19-2)10-15(13)17/h3-8,10,16,18H,9H2,1-2H3/t16-,17+/m0/s1 |
| InChIKey | PEUHCVNUHUPGFB-DLBZAZTESA-N |
| XLogP | 3.16 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.33 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |