C12H10N2O — CID 15629235
1H-pyrrolo[2,3-f]quinolin-2-ylmethanol (PubChem CID 15629235) has the molecular formula C12H10N2O and a molecular weight of 198.22 g/mol. Its IUPAC name is 1H-pyrrolo[2,3-f]quinolin-2-ylmethanol.
| Compound Name | 1H-pyrrolo[2,3-f]quinolin-2-ylmethanol |
|---|---|
| PubChem CID | 15629235 |
| Molecular Formula | C12H10N2O |
| Molecular Weight | 198.22 g/mol |
| Exact Mass | 198.08 |
| IUPAC Name | 1H-pyrrolo[2,3-f]quinolin-2-ylmethanol |
| SMILES | OCc1cc2ccc3ncccc3c2[nH]1 |
| InChI | InChI=1S/C12H10N2O/c15-7-9-6-8-3-4-11-10(12(8)14-9)2-1-5-13-11/h1-6,14-15H,7H2 |
| InChIKey | BUEQMDHPMNHBRP-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 48.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.22 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |