C16H22O — CID 15637566
(1R,5S,8R)-6-methylidenespiro[11-oxatricyclo[6.2.1.01,5]undec-9-ene-7,1'-cyclohexane] (PubChem CID 15637566) has the molecular formula C16H22O and a molecular weight of 230.35 g/mol. Its IUPAC name is (1R,5S,8R)-6-methylidenespiro[11-oxatricyclo[6.2.1.01,5]undec-9-ene-7,1'-cyclohexane].
| Compound Name | (1R,5S,8R)-6-methylidenespiro[11-oxatricyclo[6.2.1.01,5]undec-9-ene-7,1'-cyclohexane] |
|---|---|
| PubChem CID | 15637566 |
| Molecular Formula | C16H22O |
| Molecular Weight | 230.35 g/mol |
| Exact Mass | 230.17 |
| IUPAC Name | (1R,5S,8R)-6-methylidenespiro[11-oxatricyclo[6.2.1.01,5]undec-9-ene-7,1'-cyclohexane] |
| SMILES | C=C1[C@@H]2CCC[C@@]23C=C[C@@H](O3)C12CCCCC2 |
| InChI | InChI=1S/C16H22O/c1-12-13-6-5-10-16(13)11-7-14(17-16)15(12)8-3-2-4-9-15/h7,11,13-14H,1-6,8-10H2/t13-,14+,16+/m0/s1 |
| InChIKey | NHSCPVWSQIYVQL-SQWLQELKSA-N |
| XLogP | 4.00 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.35 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|