C23H19F5N4O2 — CID 156504510
N-[(1R)-8,9-difluoro-6-oxo-2,3,4,5-tetrahydro-1H-benzo[c][1,7]naphthyridin-1-yl]-N-methyl-5-(trifluoromethyl)-1,3-dihydroisoindole-2-carboxamide (PubChem CID 156504510) has the molecular formula C23H19F5N4O2 and a molecular weight of 478.42 g/mol. Its IUPAC name is N-[(1R)-8,9-difluoro-6-oxo-2,3,4,5-tetrahydro-1H-benzo[c][1,7]naphthyridin-1-yl]-N-methyl-5-(trifluoromethyl)-1,3-dihydroisoindole-2-carboxamide.
| Compound Name | N-[(1R)-8,9-difluoro-6-oxo-2,3,4,5-tetrahydro-1H-benzo[c][1,7]naphthyridin-1-yl]-N-methyl-5-(trifluoromethyl)-1,3-dihydroisoindole-2-carboxamide |
|---|---|
| PubChem CID | 156504510 |
| Molecular Formula | C23H19F5N4O2 |
| Molecular Weight | 478.42 g/mol |
| Exact Mass | 478.14 |
| IUPAC Name | N-[(1R)-8,9-difluoro-6-oxo-2,3,4,5-tetrahydro-1H-benzo[c][1,7]naphthyridin-1-yl]-N-methyl-5-(trifluoromethyl)-1,3-dihydroisoindole-2-carboxamide |
| SMILES | CN(C(=O)N1Cc2ccc(C(F)(F)F)cc2C1)[C@H]1CNCc2[nH]c(=O)c3cc(F)c(F)cc3c21 |
| InChI | InChI=1S/C23H19F5N4O2/c1-31(22(34)32-9-11-2-3-13(23(26,27)28)4-12(11)10-32)19-8-29-7-18-20(19)14-5-16(24)17(25)6-15(14)21(33)30-18/h2-6,19,29H,7-10H2,1H3,(H,30,33)/t19-/m0/s1 |
| InChIKey | BXJQBHFHVFVEFR-IBGZPJMESA-N |
| XLogP | 4.04 |
| TPSA | 68.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.42 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |