C12H20FNO2 — CID 156513466
(2E,4E)-N-(2-fluoropropyl)-9-hydroxynona-2,4-dienamide (PubChem CID 156513466) has the molecular formula C12H20FNO2 and a molecular weight of 229.30 g/mol. Its IUPAC name is (2E,4E)-N-(2-fluoropropyl)-9-hydroxynona-2,4-dienamide.
| Compound Name | (2E,4E)-N-(2-fluoropropyl)-9-hydroxynona-2,4-dienamide |
|---|---|
| PubChem CID | 156513466 |
| Molecular Formula | C12H20FNO2 |
| Molecular Weight | 229.30 g/mol |
| Exact Mass | 229.15 |
| IUPAC Name | (2E,4E)-N-(2-fluoropropyl)-9-hydroxynona-2,4-dienamide |
| SMILES | CC(F)CNC(=O)/C=C/C=C/CCCCO |
| InChI | InChI=1S/C12H20FNO2/c1-11(13)10-14-12(16)8-6-4-2-3-5-7-9-15/h2,4,6,8,11,15H,3,5,7,9-10H2,1H3,(H,14,16)/b4-2+,8-6+ |
| InChIKey | WORHVRXBHYYMDR-REBBJWOHSA-N |
| XLogP | 1.74 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.30 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|