C26H17FN4OS2 — CID 156515657
[3-[[5-(benzhydrylideneamino)-4-cyano-1,3-thiazol-2-yl]-hydroxymethyl]indol-1-yl] thiohypofluorite (PubChem CID 156515657) has the molecular formula C26H17FN4OS2 and a molecular weight of 484.58 g/mol. Its IUPAC name is [3-[[5-(benzhydrylideneamino)-4-cyano-1,3-thiazol-2-yl]-hydroxymethyl]indol-1-yl] thiohypofluorite.
| Compound Name | [3-[[5-(benzhydrylideneamino)-4-cyano-1,3-thiazol-2-yl]-hydroxymethyl]indol-1-yl] thiohypofluorite |
|---|---|
| PubChem CID | 156515657 |
| Molecular Formula | C26H17FN4OS2 |
| Molecular Weight | 484.58 g/mol |
| Exact Mass | 484.08 |
| IUPAC Name | [3-[[5-(benzhydrylideneamino)-4-cyano-1,3-thiazol-2-yl]-hydroxymethyl]indol-1-yl] thiohypofluorite |
| SMILES | N#Cc1nc(C(O)c2cn(SF)c3ccccc23)sc1N=C(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C26H17FN4OS2/c27-34-31-16-20(19-13-7-8-14-22(19)31)24(32)26-29-21(15-28)25(33-26)30-23(17-9-3-1-4-10-17)18-11-5-2-6-12-18/h1-14,16,24,32H |
| InChIKey | HXBJHCFEVMCNLF-UHFFFAOYSA-N |
| XLogP | 6.60 |
| TPSA | 74.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.58 |
| LogP ≤ 5 | 6.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|