C34H42F3N3O2 — CID 156517266
(6aR,6aS,6bR,8aS,14bS)-4,4,6a,6b,11,11,14b-heptamethyl-3,13-dioxo-8a-[5-(trifluoromethyl)pyrazol-1-yl]-4a,5,6,6a,7,8,9,10,12,12a-decahydropicene-2-carbonitrile (PubChem CID 156517266) has the molecular formula C34H42F3N3O2 and a molecular weight of 581.72 g/mol. Its IUPAC name is (6aR,6aS,6bR,8aS,14bS)-4,4,6a,6b,11,11,14b-heptamethyl-3,13-dioxo-8a-[5-(trifluoromethyl)pyrazol-1-yl]-4a,5,6,6a,7,8,9,10,12,12a-decahydropicene-2-carbonitrile.
| Compound Name | (6aR,6aS,6bR,8aS,14bS)-4,4,6a,6b,11,11,14b-heptamethyl-3,13-dioxo-8a-[5-(trifluoromethyl)pyrazol-1-yl]-4a,5,6,6a,7,8,9,10,12,12a-decahydropicene-2-carbonitrile |
|---|---|
| PubChem CID | 156517266 |
| Molecular Formula | C34H42F3N3O2 |
| Molecular Weight | 581.72 g/mol |
| Exact Mass | 581.32 |
| IUPAC Name | (6aR,6aS,6bR,8aS,14bS)-4,4,6a,6b,11,11,14b-heptamethyl-3,13-dioxo-8a-[5-(trifluoromethyl)pyrazol-1-yl]-4a,5,6,6a,7,8,9,10,12,12a-decahydropicene-2-carbonitrile |
| SMILES | CC1(C)CC[C@]2(n3nccc3C(F)(F)F)CC[C@]3(C)[C@H](C(=O)C=C4[C@@]5(C)C=C(C#N)C(=O)C(C)(C)C5CC[C@]43C)C2C1 |
| InChI | InChI=1S/C34H42F3N3O2/c1-28(2)11-13-33(40-25(9-15-39-40)34(35,36)37)14-12-32(7)26(21(33)18-28)22(41)16-24-30(5)17-20(19-38)27(42)29(3,4)23(30)8-10-31(24,32)6/h9,15-17,21,23,26H,8,10-14,18H2,1-7H3/t21?,23?,26-,30-,31+,32+,33-/m0/s1 |
| InChIKey | AHEFDZFCLDBSTA-DHZSZGNSSA-N |
| XLogP | 7.83 |
| TPSA | 75.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 581.72 |
| LogP ≤ 5 | 7.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |