C20H42OSi — CID 15652076
[(3R,4S)-4-ethenyl-2-methyloctan-3-yl]oxy-tri(propan-2-yl)silane (PubChem CID 15652076) has the molecular formula C20H42OSi and a molecular weight of 326.64 g/mol. Its IUPAC name is [(3R,4S)-4-ethenyl-2-methyloctan-3-yl]oxy-tri(propan-2-yl)silane.
| Compound Name | [(3R,4S)-4-ethenyl-2-methyloctan-3-yl]oxy-tri(propan-2-yl)silane |
|---|---|
| PubChem CID | 15652076 |
| Molecular Formula | C20H42OSi |
| Molecular Weight | 326.64 g/mol |
| Exact Mass | 326.30 |
| IUPAC Name | [(3R,4S)-4-ethenyl-2-methyloctan-3-yl]oxy-tri(propan-2-yl)silane |
| SMILES | C=C[C@H](CCCC)[C@H](O[Si](C(C)C)(C(C)C)C(C)C)C(C)C |
| InChI | InChI=1S/C20H42OSi/c1-11-13-14-19(12-2)20(15(3)4)21-22(16(5)6,17(7)8)18(9)10/h12,15-20H,2,11,13-14H2,1,3-10H3/t19-,20-/m1/s1 |
| InChIKey | OIOXYNOFVJOSIK-WOJBJXKFSA-N |
| XLogP | 7.20 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.64 |
| LogP ≤ 5 | 7.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|