C13H11BrO — CID 156530708
2-bromo-4,4-dimethylindeno[1,2-b]furan (PubChem CID 156530708) has the molecular formula C13H11BrO and a molecular weight of 263.13 g/mol. Its IUPAC name is 2-bromo-4,4-dimethylindeno[1,2-b]furan.
| Compound Name | 2-bromo-4,4-dimethylindeno[1,2-b]furan |
|---|---|
| PubChem CID | 156530708 |
| Molecular Formula | C13H11BrO |
| Molecular Weight | 263.13 g/mol |
| Exact Mass | 262.00 |
| IUPAC Name | 2-bromo-4,4-dimethylindeno[1,2-b]furan |
| SMILES | CC1(C)c2ccccc2-c2oc(Br)cc21 |
| InChI | InChI=1S/C13H11BrO/c1-13(2)9-6-4-3-5-8(9)12-10(13)7-11(14)15-12/h3-7H,1-2H3 |
| InChIKey | JDIBDWAPSDBIOH-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 13.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.13 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |