C20H21F2N3O2S — CID 156532055
3-(4,4-difluoropiperidin-1-yl)-1-(1-phenylethylsulfonyl)indazole (PubChem CID 156532055) has the molecular formula C20H21F2N3O2S and a molecular weight of 405.47 g/mol. Its IUPAC name is 3-(4,4-difluoropiperidin-1-yl)-1-(1-phenylethylsulfonyl)indazole.
| Compound Name | 3-(4,4-difluoropiperidin-1-yl)-1-(1-phenylethylsulfonyl)indazole |
|---|---|
| PubChem CID | 156532055 |
| Molecular Formula | C20H21F2N3O2S |
| Molecular Weight | 405.47 g/mol |
| Exact Mass | 405.13 |
| IUPAC Name | 3-(4,4-difluoropiperidin-1-yl)-1-(1-phenylethylsulfonyl)indazole |
| SMILES | CC(c1ccccc1)S(=O)(=O)n1nc(N2CCC(F)(F)CC2)c2ccccc21 |
| InChI | InChI=1S/C20H21F2N3O2S/c1-15(16-7-3-2-4-8-16)28(26,27)25-18-10-6-5-9-17(18)19(23-25)24-13-11-20(21,22)12-14-24/h2-10,15H,11-14H2,1H3 |
| InChIKey | KNDIQHZFPAFAQK-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 55.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.47 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |