C15H27N3O3 — CID 156533045
N-(2-aminoethyl)-2-[[2-[(2Z)-3-methylcyclooct-2-en-1-yl]oxyacetyl]amino]acetamide (PubChem CID 156533045) has the molecular formula C15H27N3O3 and a molecular weight of 297.40 g/mol. Its IUPAC name is N-(2-aminoethyl)-2-[[2-[(2Z)-3-methylcyclooct-2-en-1-yl]oxyacetyl]amino]acetamide.
| Compound Name | N-(2-aminoethyl)-2-[[2-[(2Z)-3-methylcyclooct-2-en-1-yl]oxyacetyl]amino]acetamide |
|---|---|
| PubChem CID | 156533045 |
| Molecular Formula | C15H27N3O3 |
| Molecular Weight | 297.40 g/mol |
| Exact Mass | 297.21 |
| IUPAC Name | N-(2-aminoethyl)-2-[[2-[(2Z)-3-methylcyclooct-2-en-1-yl]oxyacetyl]amino]acetamide |
| SMILES | C/C1=C/C(OCC(=O)NCC(=O)NCCN)CCCCC1 |
| InChI | InChI=1S/C15H27N3O3/c1-12-5-3-2-4-6-13(9-12)21-11-15(20)18-10-14(19)17-8-7-16/h9,13H,2-8,10-11,16H2,1H3,(H,17,19)(H,18,20)/b12-9- |
| InChIKey | CJKNPJJBGKBCQY-XFXZXTDPSA-N |
| XLogP | 0.47 |
| TPSA | 93.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.40 |
| LogP ≤ 5 | 0.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|