C13H18F3NO3 — CID 156539636
tert-butyl 3-cyclopropyl-4-oxo-3-(trifluoromethyl)pyrrolidine-1-carboxylate (PubChem CID 156539636) has the molecular formula C13H18F3NO3 and a molecular weight of 293.28 g/mol. Its IUPAC name is tert-butyl 3-cyclopropyl-4-oxo-3-(trifluoromethyl)pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl 3-cyclopropyl-4-oxo-3-(trifluoromethyl)pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 156539636 |
| Molecular Formula | C13H18F3NO3 |
| Molecular Weight | 293.28 g/mol |
| Exact Mass | 293.12 |
| IUPAC Name | tert-butyl 3-cyclopropyl-4-oxo-3-(trifluoromethyl)pyrrolidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CC(=O)C(C2CC2)(C(F)(F)F)C1 |
| InChI | InChI=1S/C13H18F3NO3/c1-11(2,3)20-10(19)17-6-9(18)12(7-17,8-4-5-8)13(14,15)16/h8H,4-7H2,1-3H3 |
| InChIKey | XJEHEBHPDLRTDU-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.28 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |