C20H22FN7O3 — CID 156542118
2-[[[[4-[[(1R,2S,3R)-2,3-dihydroxycyclopentyl]amino]-2H-pyrazolo[3,4-d]pyrimidin-3-yl]-hydroxymethyl]-methylamino]methyl]-4-fluorobenzonitrile (PubChem CID 156542118) has the molecular formula C20H22FN7O3 and a molecular weight of 427.44 g/mol. Its IUPAC name is 2-[[[[4-[[(1R,2S,3R)-2,3-dihydroxycyclopentyl]amino]-2H-pyrazolo[3,4-d]pyrimidin-3-yl]-hydroxymethyl]-methylamino]methyl]-4-fluorobenzonitrile.
| Compound Name | 2-[[[[4-[[(1R,2S,3R)-2,3-dihydroxycyclopentyl]amino]-2H-pyrazolo[3,4-d]pyrimidin-3-yl]-hydroxymethyl]-methylamino]methyl]-4-fluorobenzonitrile |
|---|---|
| PubChem CID | 156542118 |
| Molecular Formula | C20H22FN7O3 |
| Molecular Weight | 427.44 g/mol |
| Exact Mass | 427.18 |
| IUPAC Name | 2-[[[[4-[[(1R,2S,3R)-2,3-dihydroxycyclopentyl]amino]-2H-pyrazolo[3,4-d]pyrimidin-3-yl]-hydroxymethyl]-methylamino]methyl]-4-fluorobenzonitrile |
| SMILES | CN(Cc1cc(F)ccc1C#N)C(O)c1[nH]nc2ncnc(N[C@@H]3CC[C@@H](O)[C@H]3O)c12 |
| InChI | InChI=1S/C20H22FN7O3/c1-28(8-11-6-12(21)3-2-10(11)7-22)20(31)16-15-18(23-9-24-19(15)27-26-16)25-13-4-5-14(29)17(13)30/h2-3,6,9,13-14,17,20,29-31H,4-5,8H2,1H3,(H2,23,24,25,26,27)/t13-,14-,17+,20?/m1/s1 |
| InChIKey | OXWVMVZFHWPPHS-SYSVDHIGSA-N |
| XLogP | 0.78 |
| TPSA | 154.21 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.44 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|