C5H8N4O — CID 156544662
2-oxo-1,5-diazaspiro[2.3]hexane-5-carboximidamide (PubChem CID 156544662) has the molecular formula C5H8N4O and a molecular weight of 140.15 g/mol. Its IUPAC name is 2-oxo-1,5-diazaspiro[2.3]hexane-5-carboximidamide.
| Compound Name | 2-oxo-1,5-diazaspiro[2.3]hexane-5-carboximidamide |
|---|---|
| PubChem CID | 156544662 |
| Molecular Formula | C5H8N4O |
| Molecular Weight | 140.15 g/mol |
| Exact Mass | 140.07 |
| IUPAC Name | 2-oxo-1,5-diazaspiro[2.3]hexane-5-carboximidamide |
| SMILES | [H]/N=C(\N)N1CC2(C1)NC2=O |
| InChI | InChI=1S/C5H8N4O/c6-4(7)9-1-5(2-9)3(10)8-5/h1-2H2,(H3,6,7)(H,8,10) |
| InChIKey | PSEMJXKDERHESJ-UHFFFAOYSA-N |
| XLogP | -1.94 |
| TPSA | 92.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 140.15 |
| LogP ≤ 5 | -1.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|