C4H5N5O3 — CID 54027278
2,4,6-trioxo-1,3,5-triazinane-1-carboximidamide (PubChem CID 54027278) has the molecular formula C4H5N5O3 and a molecular weight of 171.12 g/mol. Its IUPAC name is 2,4,6-trioxo-1,3,5-triazinane-1-carboximidamide.
| Compound Name | 2,4,6-trioxo-1,3,5-triazinane-1-carboximidamide |
|---|---|
| PubChem CID | 54027278 |
| Molecular Formula | C4H5N5O3 |
| Molecular Weight | 171.12 g/mol |
| Exact Mass | 171.04 |
| IUPAC Name | 2,4,6-trioxo-1,3,5-triazinane-1-carboximidamide |
| SMILES | [H]/N=C(\N)n1c(=O)[nH]c(=O)[nH]c1=O |
| InChI | InChI=1S/C4H5N5O3/c5-1(6)9-3(11)7-2(10)8-4(9)12/h(H3,5,6)(H2,7,8,10,11,12) |
| InChIKey | LDBVXZXNPHVIDG-UHFFFAOYSA-N |
| XLogP | -3.03 |
| TPSA | 137.59 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 171.12 |
| LogP ≤ 5 | -3.03 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|