C18H25FN2O3 — CID 156549433
tert-butyl N-[(5S)-6-(4-fluoroanilino)-5-methyl-6-oxohex-1-en-2-yl]carbamate (PubChem CID 156549433) has the molecular formula C18H25FN2O3 and a molecular weight of 336.41 g/mol. Its IUPAC name is tert-butyl N-[(5S)-6-(4-fluoroanilino)-5-methyl-6-oxohex-1-en-2-yl]carbamate.
| Compound Name | tert-butyl N-[(5S)-6-(4-fluoroanilino)-5-methyl-6-oxohex-1-en-2-yl]carbamate |
|---|---|
| PubChem CID | 156549433 |
| Molecular Formula | C18H25FN2O3 |
| Molecular Weight | 336.41 g/mol |
| Exact Mass | 336.18 |
| IUPAC Name | tert-butyl N-[(5S)-6-(4-fluoroanilino)-5-methyl-6-oxohex-1-en-2-yl]carbamate |
| SMILES | C=C(CC[C@H](C)C(=O)Nc1ccc(F)cc1)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C18H25FN2O3/c1-12(16(22)21-15-10-8-14(19)9-11-15)6-7-13(2)20-17(23)24-18(3,4)5/h8-12H,2,6-7H2,1,3-5H3,(H,20,23)(H,21,22)/t12-/m0/s1 |
| InChIKey | OJLKDJOQXPQFNR-LBPRGKRZSA-N |
| XLogP | 4.22 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.41 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |