C18H18F4N4O — CID 156550235
N-(4-fluorophenyl)-2-methyl-5-[[6-(trifluoromethyl)pyrimidin-4-yl]amino]hex-5-enamide (PubChem CID 156550235) has the molecular formula C18H18F4N4O and a molecular weight of 382.36 g/mol. Its IUPAC name is N-(4-fluorophenyl)-2-methyl-5-[[6-(trifluoromethyl)pyrimidin-4-yl]amino]hex-5-enamide.
| Compound Name | N-(4-fluorophenyl)-2-methyl-5-[[6-(trifluoromethyl)pyrimidin-4-yl]amino]hex-5-enamide |
|---|---|
| PubChem CID | 156550235 |
| Molecular Formula | C18H18F4N4O |
| Molecular Weight | 382.36 g/mol |
| Exact Mass | 382.14 |
| IUPAC Name | N-(4-fluorophenyl)-2-methyl-5-[[6-(trifluoromethyl)pyrimidin-4-yl]amino]hex-5-enamide |
| SMILES | C=C(CCC(C)C(=O)Nc1ccc(F)cc1)Nc1cc(C(F)(F)F)ncn1 |
| InChI | InChI=1S/C18H18F4N4O/c1-11(17(27)26-14-7-5-13(19)6-8-14)3-4-12(2)25-16-9-15(18(20,21)22)23-10-24-16/h5-11H,2-4H2,1H3,(H,26,27)(H,23,24,25) |
| InChIKey | SURFRKPRIHDWMK-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 66.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.36 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |